About 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid
2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid (PubChem CID 130590503) has the molecular formula C8H9NO3S
and a molecular weight of 199.23 g/mol. Its IUPAC name is 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid |
| PubChem CID | 130590503 |
| Molecular Formula | C8H9NO3S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid |
| SMILES | COc1ncc(C2CC2C(=O)O)s1 |
| InChI | InChI=1S/C8H9NO3S/c1-12-8-9-3-6(13-8)4-2-5(4)7(10)11/h3-5H,2H2,1H3,(H,10,11) |
| InChIKey | JNMBRBRKTKOMLS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid?
The IUPAC name of 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid (CID 130590503) is 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid is COc1ncc(C2CC2C(=O)O)s1.
What is the InChIKey of 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid?
The InChIKey is JNMBRBRKTKOMLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3S/c1-12-8-9-3-6(13-8)4-2-5(4)7(10)11/h3-5H,2H2,1H3,(H,10,11).
What are the key properties of 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid?
2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid has a molecular weight of 199.23 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxy-1,3-thiazol-5-yl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 130590503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).