About 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole
5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole (PubChem CID 130590598) has the molecular formula C9H14N2OS
and a molecular weight of 198.29 g/mol. Its IUPAC name is 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole.
Molecular Properties
| Compound Name | 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole |
| PubChem CID | 130590598 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole |
| SMILES | COc1ncc(C2NCC2(C)C)s1 |
| InChI | InChI=1S/C9H14N2OS/c1-9(2)5-11-7(9)6-4-10-8(12-3)13-6/h4,7,11H,5H2,1-3H3 |
| InChIKey | DMSOAZSYDQUGQB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole?
The IUPAC name of 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole (CID 130590598) is 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole.
What is the SMILES notation for 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole?
The canonical SMILES for 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole is COc1ncc(C2NCC2(C)C)s1.
What is the InChIKey of 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole?
The InChIKey is DMSOAZSYDQUGQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS/c1-9(2)5-11-7(9)6-4-10-8(12-3)13-6/h4,7,11H,5H2,1-3H3.
What are the key properties of 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole?
5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole has a molecular weight of 198.29 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-dimethylazetidin-2-yl)-2-methoxy-1,3-thiazole is sourced from PubChem (CID 130590598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).