About 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole
3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole (PubChem CID 130591033) has the molecular formula C10H8IN3S
and a molecular weight of 329.17 g/mol. Its IUPAC name is 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole |
| PubChem CID | 130591033 |
| Molecular Formula | C10H8IN3S |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole |
| SMILES | Ic1nc(-c2ccc3c(n2)CCC3)ns1 |
| InChI | InChI=1S/C10H8IN3S/c11-10-13-9(14-15-10)8-5-4-6-2-1-3-7(6)12-8/h4-5H,1-3H2 |
| InChIKey | ZFKOEKBOTNCVPI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole?
The IUPAC name of 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole (CID 130591033) is 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole.
What is the SMILES notation for 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole?
The canonical SMILES for 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole is Ic1nc(-c2ccc3c(n2)CCC3)ns1.
What is the InChIKey of 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole?
The InChIKey is ZFKOEKBOTNCVPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8IN3S/c11-10-13-9(14-15-10)8-5-4-6-2-1-3-7(6)12-8/h4-5H,1-3H2.
What are the key properties of 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole?
3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole has a molecular weight of 329.17 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-5-iodo-1,2,4-thiadiazole is sourced from PubChem (CID 130591033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).