About 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea (PubChem CID 1305919) has the molecular formula C20H22N4O2
and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea.
Molecular Properties
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea |
| PubChem CID | 1305919 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2c(C)n(C)n(-c3ccccc3)c2=O)cc1C |
| InChI | InChI=1S/C20H22N4O2/c1-13-10-11-16(12-14(13)2)21-20(26)22-18-15(3)23(4)24(19(18)25)17-8-6-5-7-9-17/h5-12H,1-4H3,(H2,21,22,26) |
| InChIKey | RXPZJJBRVDNYRZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea?
The IUPAC name of 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea (CID 1305919) is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea.
What is the SMILES notation for 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea?
The canonical SMILES for 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea is Cc1ccc(NC(=O)Nc2c(C)n(C)n(-c3ccccc3)c2=O)cc1C.
What is the InChIKey of 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea?
The InChIKey is RXPZJJBRVDNYRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O2/c1-13-10-11-16(12-14(13)2)21-20(26)22-18-15(3)23(4)24(19(18)25)17-8-6-5-7-9-17/h5-12H,1-4H3,(H2,21,22,26).
What are the key properties of 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea?
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea has a molecular weight of 350.42 g/mol, XLogP of 3.75, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(3,4-dimethylphenyl)urea is sourced from PubChem (CID 1305919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).