About 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one
3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one (PubChem CID 13059206) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one.
Molecular Properties
| Compound Name | 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one |
| PubChem CID | 13059206 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one |
| SMILES | COCC1CC(=O)C1(C)C |
| InChI | InChI=1S/C8H14O2/c1-8(2)6(5-10-3)4-7(8)9/h6H,4-5H2,1-3H3 |
| InChIKey | XGMCHFWCOQBCSO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one?
The IUPAC name of 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one (CID 13059206) is 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one.
What is the SMILES notation for 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one?
The canonical SMILES for 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one is COCC1CC(=O)C1(C)C.
What is the InChIKey of 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one?
The InChIKey is XGMCHFWCOQBCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-8(2)6(5-10-3)4-7(8)9/h6H,4-5H2,1-3H3.
What are the key properties of 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one?
3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one has a molecular weight of 142.20 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-2,2-dimethylcyclobutan-1-one is sourced from PubChem (CID 13059206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).