C12H21N3O3 — CID 13059222
1,3,5-tri(propan-2-yl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 13059222) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1,3,5-tri(propan-2-yl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tri(propan-2-yl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 13059222 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1,3,5-tri(propan-2-yl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC(C)n1c(=O)n(C(C)C)c(=O)n(C(C)C)c1=O |
| InChI | InChI=1S/C12H21N3O3/c1-7(2)13-10(16)14(8(3)4)12(18)15(9(5)6)11(13)17/h7-9H,1-6H3 |
| InChIKey | ANTYIPKBBPKYAI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |