C13H16O — CID 130592334
2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)oxirane (PubChem CID 130592334) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)oxirane.
| Compound Name | 2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)oxirane |
|---|---|
| PubChem CID | 130592334 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)oxirane |
| SMILES | c1cc2c(cc1CC1CO1)CCCC2 |
| InChI | InChI=1S/C13H16O/c1-2-4-12-7-10(8-13-9-14-13)5-6-11(12)3-1/h5-7,13H,1-4,8-9H2 |
| InChIKey | DZNHHAIPWFRQLM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|