About 3-(2-methoxy-1,3-thiazol-5-yl)aniline
3-(2-methoxy-1,3-thiazol-5-yl)aniline (PubChem CID 130593160) has the molecular formula C10H10N2OS
and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-(2-methoxy-1,3-thiazol-5-yl)aniline.
Molecular Properties
| Compound Name | 3-(2-methoxy-1,3-thiazol-5-yl)aniline |
| PubChem CID | 130593160 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 3-(2-methoxy-1,3-thiazol-5-yl)aniline |
| SMILES | COc1ncc(-c2cccc(N)c2)s1 |
| InChI | InChI=1S/C10H10N2OS/c1-13-10-12-6-9(14-10)7-3-2-4-8(11)5-7/h2-6H,11H2,1H3 |
| InChIKey | URCXJXUQHOWTTI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methoxy-1,3-thiazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxy-1,3-thiazol-5-yl)aniline?
The IUPAC name of 3-(2-methoxy-1,3-thiazol-5-yl)aniline (CID 130593160) is 3-(2-methoxy-1,3-thiazol-5-yl)aniline.
What is the SMILES notation for 3-(2-methoxy-1,3-thiazol-5-yl)aniline?
The canonical SMILES for 3-(2-methoxy-1,3-thiazol-5-yl)aniline is COc1ncc(-c2cccc(N)c2)s1.
What is the InChIKey of 3-(2-methoxy-1,3-thiazol-5-yl)aniline?
The InChIKey is URCXJXUQHOWTTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS/c1-13-10-12-6-9(14-10)7-3-2-4-8(11)5-7/h2-6H,11H2,1H3.
What are the key properties of 3-(2-methoxy-1,3-thiazol-5-yl)aniline?
3-(2-methoxy-1,3-thiazol-5-yl)aniline has a molecular weight of 206.27 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxy-1,3-thiazol-5-yl)aniline is sourced from PubChem (CID 130593160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).