C8H9FN4 — CID 130593710
5-fluoro-2-N-methyl-2-N-prop-2-ynylpyrimidine-2,4-diamine (PubChem CID 130593710) has the molecular formula C8H9FN4 and a molecular weight of 180.19 g/mol. Its IUPAC name is 5-fluoro-2-N-methyl-2-N-prop-2-ynylpyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-methyl-2-N-prop-2-ynylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 130593710 |
| Molecular Formula | C8H9FN4 |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 5-fluoro-2-N-methyl-2-N-prop-2-ynylpyrimidine-2,4-diamine |
| SMILES | C#CCN(C)c1ncc(F)c(N)n1 |
| InChI | InChI=1S/C8H9FN4/c1-3-4-13(2)8-11-5-6(9)7(10)12-8/h1,5H,4H2,2H3,(H2,10,11,12) |
| InChIKey | DRCVTJAESZPVAZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|