About N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide
N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide (PubChem CID 13059659) has the molecular formula C16H16BrCl2N3
and a molecular weight of 401.14 g/mol. Its IUPAC name is N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide |
| PubChem CID | 13059659 |
| Molecular Formula | C16H16BrCl2N3 |
| Molecular Weight | 401.14 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1c(Cl)cc(NCc2cccc(Br)c2)cc1Cl |
| InChI | InChI=1S/C16H16BrCl2N3/c1-22(2)10-21-16-14(18)7-13(8-15(16)19)20-9-11-4-3-5-12(17)6-11/h3-8,10,20H,9H2,1-2H3/b21-10+ |
| InChIKey | NUCVIRGZFUZQEA-UFFVCSGVSA-N |
| XLogP | 5.59 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.14 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide?
The IUPAC name of N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide (CID 13059659) is N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide is CN(C)/C=N/c1c(Cl)cc(NCc2cccc(Br)c2)cc1Cl.
What is the InChIKey of N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide?
The InChIKey is NUCVIRGZFUZQEA-UFFVCSGVSA-N. The full InChI is InChI=1S/C16H16BrCl2N3/c1-22(2)10-21-16-14(18)7-13(8-15(16)19)20-9-11-4-3-5-12(17)6-11/h3-8,10,20H,9H2,1-2H3/b21-10+.
What are the key properties of N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide?
N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide has a molecular weight of 401.14 g/mol, XLogP of 5.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-[(3-bromophenyl)methylamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide is sourced from PubChem (CID 13059659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).