C15H14Cl2FN3 — CID 13059678
2,6-dichloro-4-[[4-(dimethylamino)-2-fluorophenyl]methylideneamino]aniline (PubChem CID 13059678) has the molecular formula C15H14Cl2FN3 and a molecular weight of 326.20 g/mol. Its IUPAC name is 2,6-dichloro-4-[[4-(dimethylamino)-2-fluorophenyl]methylideneamino]aniline.
| Compound Name | 2,6-dichloro-4-[[4-(dimethylamino)-2-fluorophenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 13059678 |
| Molecular Formula | C15H14Cl2FN3 |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2,6-dichloro-4-[[4-(dimethylamino)-2-fluorophenyl]methylideneamino]aniline |
| SMILES | CN(C)c1ccc(/C=N/c2cc(Cl)c(N)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C15H14Cl2FN3/c1-21(2)11-4-3-9(14(18)7-11)8-20-10-5-12(16)15(19)13(17)6-10/h3-8H,19H2,1-2H3/b20-8+ |
| InChIKey | YPYIOZKWXXDUKL-DNTJNYDQSA-N |
| XLogP | 4.53 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|