C9H15N5 — CID 130596868
3-N-(cyclohex-3-en-1-ylmethyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 130596868) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-N-(cyclohex-3-en-1-ylmethyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(cyclohex-3-en-1-ylmethyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 130596868 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 3-N-(cyclohex-3-en-1-ylmethyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(NCC2CC=CCC2)n[nH]1 |
| InChI | InChI=1S/C9H15N5/c10-8-12-9(14-13-8)11-6-7-4-2-1-3-5-7/h1-2,7H,3-6H2,(H4,10,11,12,13,14) |
| InChIKey | BHNBFXYBSFXIOD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|