C5H3BrIN5S — CID 130597597
2-(5-bromo-3-methyltriazol-4-yl)-5-iodo-1,3,4-thiadiazole (PubChem CID 130597597) has the molecular formula C5H3BrIN5S and a molecular weight of 371.99 g/mol. Its IUPAC name is 2-(5-bromo-3-methyltriazol-4-yl)-5-iodo-1,3,4-thiadiazole.
| Compound Name | 2-(5-bromo-3-methyltriazol-4-yl)-5-iodo-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130597597 |
| Molecular Formula | C5H3BrIN5S |
| Molecular Weight | 371.99 g/mol |
| Exact Mass | 370.83 |
| IUPAC Name | 2-(5-bromo-3-methyltriazol-4-yl)-5-iodo-1,3,4-thiadiazole |
| SMILES | Cn1nnc(Br)c1-c1nnc(I)s1 |
| InChI | InChI=1S/C5H3BrIN5S/c1-12-2(3(6)8-11-12)4-9-10-5(7)13-4/h1H3 |
| InChIKey | KWKGXEWTOAKPID-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.99 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|