About 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile
2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 13059832) has the molecular formula C17H21N5O2S
and a molecular weight of 359.46 g/mol. Its IUPAC name is 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile |
| PubChem CID | 13059832 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCN(CCCCN2C(=O)CSC2=O)CC1 |
| InChI | InChI=1S/C17H21N5O2S/c18-12-14-4-3-5-19-16(14)21-10-8-20(9-11-21)6-1-2-7-22-15(23)13-25-17(22)24/h3-5H,1-2,6-11,13H2 |
| InChIKey | SAJRFAVYAIWUNH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 80.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile?
The IUPAC name of 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile (CID 13059832) is 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile.
What is the SMILES notation for 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile?
The canonical SMILES for 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile is N#Cc1cccnc1N1CCN(CCCCN2C(=O)CSC2=O)CC1.
What is the InChIKey of 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile?
The InChIKey is SAJRFAVYAIWUNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5O2S/c18-12-14-4-3-5-19-16(14)21-10-8-20(9-11-21)6-1-2-7-22-15(23)13-25-17(22)24/h3-5H,1-2,6-11,13H2.
What are the key properties of 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile?
2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile has a molecular weight of 359.46 g/mol, XLogP of 1.55, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile is sourced from PubChem (CID 13059832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).