C7H12N4S — CID 130599104
4-methyl-2-(1-methyltriazol-4-yl)-1,3-thiazolidine (PubChem CID 130599104) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is 4-methyl-2-(1-methyltriazol-4-yl)-1,3-thiazolidine.
| Compound Name | 4-methyl-2-(1-methyltriazol-4-yl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 130599104 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 4-methyl-2-(1-methyltriazol-4-yl)-1,3-thiazolidine |
| SMILES | CC1CSC(c2cn(C)nn2)N1 |
| InChI | InChI=1S/C7H12N4S/c1-5-4-12-7(8-5)6-3-11(2)10-9-6/h3,5,7-8H,4H2,1-2H3 |
| InChIKey | AQUNBFAQRQAABS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |