About ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate
ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate (PubChem CID 13060078) has the molecular formula C9H10N2O2S
and a molecular weight of 210.26 g/mol. Its IUPAC name is ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate |
| PubChem CID | 13060078 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate |
| SMILES | CCOC(=O)c1nc2sccn2c1C |
| InChI | InChI=1S/C9H10N2O2S/c1-3-13-8(12)7-6(2)11-4-5-14-9(11)10-7/h4-5H,3H2,1-2H3 |
| InChIKey | HIRYIJZABCVZRP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate?
The IUPAC name of ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate (CID 13060078) is ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate.
What is the SMILES notation for ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate?
The canonical SMILES for ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate is CCOC(=O)c1nc2sccn2c1C.
What is the InChIKey of ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate?
The InChIKey is HIRYIJZABCVZRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2S/c1-3-13-8(12)7-6(2)11-4-5-14-9(11)10-7/h4-5H,3H2,1-2H3.
What are the key properties of ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate?
ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate has a molecular weight of 210.26 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-methylimidazo[2,1-b][1,3]thiazole-6-carboxylate is sourced from PubChem (CID 13060078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).