About (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol
(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol (PubChem CID 13060090) has the molecular formula C7H8N2OS
and a molecular weight of 168.22 g/mol. Its IUPAC name is (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol.
Molecular Properties
| Compound Name | (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol |
| PubChem CID | 13060090 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol |
| SMILES | Cc1csc2nc(CO)cn12 |
| InChI | InChI=1S/C7H8N2OS/c1-5-4-11-7-8-6(3-10)2-9(5)7/h2,4,10H,3H2,1H3 |
| InChIKey | CTGIMFUPVPDASG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol?
The IUPAC name of (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol (CID 13060090) is (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol.
What is the SMILES notation for (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol?
The canonical SMILES for (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol is Cc1csc2nc(CO)cn12.
What is the InChIKey of (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol?
The InChIKey is CTGIMFUPVPDASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2OS/c1-5-4-11-7-8-6(3-10)2-9(5)7/h2,4,10H,3H2,1H3.
What are the key properties of (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol?
(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol has a molecular weight of 168.22 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methanol is sourced from PubChem (CID 13060090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).