About 3-amino-2,2-difluoro-N-methylsulfonylpropanamide
3-amino-2,2-difluoro-N-methylsulfonylpropanamide (PubChem CID 130600904) has the molecular formula C4H8F2N2O3S
and a molecular weight of 202.18 g/mol. Its IUPAC name is 3-amino-2,2-difluoro-N-methylsulfonylpropanamide.
Molecular Properties
| Compound Name | 3-amino-2,2-difluoro-N-methylsulfonylpropanamide |
| PubChem CID | 130600904 |
| Molecular Formula | C4H8F2N2O3S |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 3-amino-2,2-difluoro-N-methylsulfonylpropanamide |
| SMILES | CS(=O)(=O)NC(=O)C(F)(F)CN |
| InChI | InChI=1S/C4H8F2N2O3S/c1-12(10,11)8-3(9)4(5,6)2-7/h2,7H2,1H3,(H,8,9) |
| InChIKey | ZWHSWMLISONRFJ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2,2-difluoro-N-methylsulfonylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,2-difluoro-N-methylsulfonylpropanamide?
The IUPAC name of 3-amino-2,2-difluoro-N-methylsulfonylpropanamide (CID 130600904) is 3-amino-2,2-difluoro-N-methylsulfonylpropanamide.
What is the SMILES notation for 3-amino-2,2-difluoro-N-methylsulfonylpropanamide?
The canonical SMILES for 3-amino-2,2-difluoro-N-methylsulfonylpropanamide is CS(=O)(=O)NC(=O)C(F)(F)CN.
What is the InChIKey of 3-amino-2,2-difluoro-N-methylsulfonylpropanamide?
The InChIKey is ZWHSWMLISONRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8F2N2O3S/c1-12(10,11)8-3(9)4(5,6)2-7/h2,7H2,1H3,(H,8,9).
What are the key properties of 3-amino-2,2-difluoro-N-methylsulfonylpropanamide?
3-amino-2,2-difluoro-N-methylsulfonylpropanamide has a molecular weight of 202.18 g/mol, XLogP of -1.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,2-difluoro-N-methylsulfonylpropanamide is sourced from PubChem (CID 130600904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).