About 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide
2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide (PubChem CID 130600998) has the molecular formula C8H14N6
and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide |
| PubChem CID | 130600998 |
| Molecular Formula | C8H14N6 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCCC1c1nncn1C |
| InChI | InChI=1S/C8H14N6/c1-13-5-11-12-7(13)6-3-2-4-14(6)8(9)10/h5-6H,2-4H2,1H3,(H3,9,10) |
| InChIKey | PYMZPAFKDOTYDN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide?
The IUPAC name of 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide (CID 130600998) is 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide.
What is the SMILES notation for 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide?
The canonical SMILES for 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide is [H]/N=C(\N)N1CCCC1c1nncn1C.
What is the InChIKey of 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide?
The InChIKey is PYMZPAFKDOTYDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N6/c1-13-5-11-12-7(13)6-3-2-4-14(6)8(9)10/h5-6H,2-4H2,1H3,(H3,9,10).
What are the key properties of 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide?
2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide has a molecular weight of 194.24 g/mol, XLogP of -0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboximidamide is sourced from PubChem (CID 130600998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).