About N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide
N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide (PubChem CID 1306035) has the molecular formula C26H20N2O4
and a molecular weight of 424.46 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide.
Molecular Properties
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide |
| PubChem CID | 1306035 |
| Molecular Formula | C26H20N2O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)Nc1oc(-c2ccccc2)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C26H20N2O4/c1-30-21-14-8-9-15-22(21)31-17-23(29)28-26-20(16-27)24(18-10-4-2-5-11-18)25(32-26)19-12-6-3-7-13-19/h2-15H,17H2,1H3,(H,28,29) |
| InChIKey | ITLHIDIRQNKPHC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide?
The IUPAC name of N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide (CID 1306035) is N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide.
What is the SMILES notation for N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide?
The canonical SMILES for N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide is COc1ccccc1OCC(=O)Nc1oc(-c2ccccc2)c(-c2ccccc2)c1C#N.
What is the InChIKey of N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide?
The InChIKey is ITLHIDIRQNKPHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N2O4/c1-30-21-14-8-9-15-22(21)31-17-23(29)28-26-20(16-27)24(18-10-4-2-5-11-18)25(32-26)19-12-6-3-7-13-19/h2-15H,17H2,1H3,(H,28,29).
What are the key properties of N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide?
N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide has a molecular weight of 424.46 g/mol, XLogP of 5.51, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(2-methoxyphenoxy)acetamide is sourced from PubChem (CID 1306035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).