C12H16N2 — CID 130604392
N'-(3-ethynylphenyl)-2-methylpropane-1,3-diamine (PubChem CID 130604392) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N'-(3-ethynylphenyl)-2-methylpropane-1,3-diamine.
| Compound Name | N'-(3-ethynylphenyl)-2-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 130604392 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N'-(3-ethynylphenyl)-2-methylpropane-1,3-diamine |
| SMILES | C#Cc1cccc(NCC(C)CN)c1 |
| InChI | InChI=1S/C12H16N2/c1-3-11-5-4-6-12(7-11)14-9-10(2)8-13/h1,4-7,10,14H,8-9,13H2,2H3 |
| InChIKey | GUDADVNVVWRHRN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|