C9H12F2N2S — CID 130604829
(3,3-difluorocyclopentyl)-(1,2-thiazol-3-yl)methanamine (PubChem CID 130604829) has the molecular formula C9H12F2N2S and a molecular weight of 218.27 g/mol. Its IUPAC name is (3,3-difluorocyclopentyl)-(1,2-thiazol-3-yl)methanamine.
| Compound Name | (3,3-difluorocyclopentyl)-(1,2-thiazol-3-yl)methanamine |
|---|---|
| PubChem CID | 130604829 |
| Molecular Formula | C9H12F2N2S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | (3,3-difluorocyclopentyl)-(1,2-thiazol-3-yl)methanamine |
| SMILES | NC(c1ccsn1)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H12F2N2S/c10-9(11)3-1-6(5-9)8(12)7-2-4-14-13-7/h2,4,6,8H,1,3,5,12H2 |
| InChIKey | KCHCGHDZYQEURU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |