C8H11FN2S — CID 130604900
3-[fluoro(pyrrolidin-2-yl)methyl]-1,2-thiazole (PubChem CID 130604900) has the molecular formula C8H11FN2S and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-[fluoro(pyrrolidin-2-yl)methyl]-1,2-thiazole.
| Compound Name | 3-[fluoro(pyrrolidin-2-yl)methyl]-1,2-thiazole |
|---|---|
| PubChem CID | 130604900 |
| Molecular Formula | C8H11FN2S |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 3-[fluoro(pyrrolidin-2-yl)methyl]-1,2-thiazole |
| SMILES | FC(c1ccsn1)C1CCCN1 |
| InChI | InChI=1S/C8H11FN2S/c9-8(6-2-1-4-10-6)7-3-5-12-11-7/h3,5-6,8,10H,1-2,4H2 |
| InChIKey | OPMYBASQGGNZEF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |