About 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole
4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole (PubChem CID 130607013) has the molecular formula C7H7BrF2N2S
and a molecular weight of 269.11 g/mol. Its IUPAC name is 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole |
| PubChem CID | 130607013 |
| Molecular Formula | C7H7BrF2N2S |
| Molecular Weight | 269.11 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole |
| SMILES | FC1(F)CCN(c2nc(Br)cs2)C1 |
| InChI | InChI=1S/C7H7BrF2N2S/c8-5-3-13-6(11-5)12-2-1-7(9,10)4-12/h3H,1-2,4H2 |
| InChIKey | NLZICMBZGIGRCT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.11 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole?
The IUPAC name of 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole (CID 130607013) is 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole.
What is the SMILES notation for 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole?
The canonical SMILES for 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole is FC1(F)CCN(c2nc(Br)cs2)C1.
What is the InChIKey of 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole?
The InChIKey is NLZICMBZGIGRCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrF2N2S/c8-5-3-13-6(11-5)12-2-1-7(9,10)4-12/h3H,1-2,4H2.
What are the key properties of 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole?
4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole has a molecular weight of 269.11 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(3,3-difluoropyrrolidin-1-yl)-1,3-thiazole is sourced from PubChem (CID 130607013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).