C10H19ClN2O — CID 130608443
(4aR,7aS)-4-(cyclopropylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride (PubChem CID 130608443) has the molecular formula C10H19ClN2O and a molecular weight of 218.73 g/mol. Its IUPAC name is (4aR,7aS)-4-(cyclopropylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride.
| Compound Name | (4aR,7aS)-4-(cyclopropylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride |
|---|---|
| PubChem CID | 130608443 |
| Molecular Formula | C10H19ClN2O |
| Molecular Weight | 218.73 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (4aR,7aS)-4-(cyclopropylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride |
| SMILES | C1CN(CC2CC2)[C@@H]2CNC[C@@H]2O1.Cl |
| InChI | InChI=1S/C10H18N2O.ClH/c1-2-8(1)7-12-3-4-13-10-6-11-5-9(10)12;/h8-11H,1-7H2;1H/t9-,10+;/m1./s1 |
| InChIKey | QAZGBPIZFDFBHK-UXQCFNEQSA-N |
| XLogP | 0.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.73 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |