About N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride
N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride (PubChem CID 130609000) has the molecular formula C7H12ClN3OS
and a molecular weight of 221.71 g/mol. Its IUPAC name is N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride |
| PubChem CID | 130609000 |
| Molecular Formula | C7H12ClN3OS |
| Molecular Weight | 221.71 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride |
| SMILES | Cl.[H]/N=c1\sccn1CC(=O)NCC |
| InChI | InChI=1S/C7H11N3OS.ClH/c1-2-9-6(11)5-10-3-4-12-7(10)8;/h3-4,8H,2,5H2,1H3,(H,9,11);1H/b8-7-; |
| InChIKey | JFAORZKJBRVQLL-CFYXSCKTSA-N |
| XLogP | 0.59 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.71 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride?
The IUPAC name of N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride (CID 130609000) is N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride.
What is the SMILES notation for N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride?
The canonical SMILES for N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride is Cl.[H]/N=c1\sccn1CC(=O)NCC.
What is the InChIKey of N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride?
The InChIKey is JFAORZKJBRVQLL-CFYXSCKTSA-N. The full InChI is InChI=1S/C7H11N3OS.ClH/c1-2-9-6(11)5-10-3-4-12-7(10)8;/h3-4,8H,2,5H2,1H3,(H,9,11);1H/b8-7-;.
What are the key properties of N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride?
N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride has a molecular weight of 221.71 g/mol, XLogP of 0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(2-imino-1,3-thiazol-3-yl)acetamide;hydrochloride is sourced from PubChem (CID 130609000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).