About (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine
(4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine (PubChem CID 130609322) has the molecular formula C11H14INO
and a molecular weight of 303.14 g/mol. Its IUPAC name is (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine.
Molecular Properties
| Compound Name | (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine |
| PubChem CID | 130609322 |
| Molecular Formula | C11H14INO |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCc1c(I)ccc2c1OCC[C@@H]2N |
| InChI | InChI=1S/C11H14INO/c1-2-7-9(12)4-3-8-10(13)5-6-14-11(7)8/h3-4,10H,2,5-6,13H2,1H3/t10-/m0/s1 |
| InChIKey | FONMMKSQBYGVHW-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine?
The IUPAC name of (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine (CID 130609322) is (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine.
What is the SMILES notation for (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine?
The canonical SMILES for (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine is CCc1c(I)ccc2c1OCC[C@@H]2N.
What is the InChIKey of (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine?
The InChIKey is FONMMKSQBYGVHW-JTQLQIEISA-N. The full InChI is InChI=1S/C11H14INO/c1-2-7-9(12)4-3-8-10(13)5-6-14-11(7)8/h3-4,10H,2,5-6,13H2,1H3/t10-/m0/s1.
What are the key properties of (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine?
(4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine has a molecular weight of 303.14 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-8-ethyl-7-iodo-3,4-dihydro-2H-chromen-4-amine is sourced from PubChem (CID 130609322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).