About 1-benzyl-2-bromobenzene
1-benzyl-2-bromobenzene (PubChem CID 13061) has the molecular formula C13H11Br
and a molecular weight of 247.14 g/mol. Its IUPAC name is 1-benzyl-2-bromobenzene.
Molecular Properties
| Compound Name | 1-benzyl-2-bromobenzene |
| PubChem CID | 13061 |
| Molecular Formula | C13H11Br |
| Molecular Weight | 247.14 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 1-benzyl-2-bromobenzene |
| SMILES | Brc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C13H11Br/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | DLCYFIIONMLNAJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.14 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-benzyl-2-bromobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-bromobenzene?
The IUPAC name of 1-benzyl-2-bromobenzene (CID 13061) is 1-benzyl-2-bromobenzene.
What is the SMILES notation for 1-benzyl-2-bromobenzene?
The canonical SMILES for 1-benzyl-2-bromobenzene is Brc1ccccc1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2-bromobenzene?
The InChIKey is DLCYFIIONMLNAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Br/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9H,10H2.
What are the key properties of 1-benzyl-2-bromobenzene?
1-benzyl-2-bromobenzene has a molecular weight of 247.14 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-bromobenzene is sourced from PubChem (CID 13061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).