C10H15ClN2OS — CID 130610268
4-chloro-N-(3-propyloxolan-3-yl)-1,3-thiazol-2-amine (PubChem CID 130610268) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is 4-chloro-N-(3-propyloxolan-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-N-(3-propyloxolan-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130610268 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 4-chloro-N-(3-propyloxolan-3-yl)-1,3-thiazol-2-amine |
| SMILES | CCCC1(Nc2nc(Cl)cs2)CCOC1 |
| InChI | InChI=1S/C10H15ClN2OS/c1-2-3-10(4-5-14-7-10)13-9-12-8(11)6-15-9/h6H,2-5,7H2,1H3,(H,12,13) |
| InChIKey | QUCJVPXCRDJINS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |