About 5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one
5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one (PubChem CID 130610602) has the molecular formula C7H8N4OS
and a molecular weight of 196.24 g/mol. Its IUPAC name is 5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one.
Analyze 5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one?
The IUPAC name of 5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one (CID 130610602) is 5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one.
What is the SMILES notation for 5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one?
The canonical SMILES for 5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one is Cc1nn(Cn2cccn2)c(=O)s1.
What is the InChIKey of 5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one?
The InChIKey is HWBPFNGRRCJSRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4OS/c1-6-9-11(7(12)13-6)5-10-4-2-3-8-10/h2-4H,5H2,1H3.
What are the key properties of 5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one?
5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one has a molecular weight of 196.24 g/mol, XLogP of 0.32, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(pyrazol-1-ylmethyl)-1,3,4-thiadiazol-2-one is sourced from PubChem (CID 130610602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).