C9H12FN3 — CID 130611542
2-(2,4-dimethylazetidin-1-yl)-5-fluoropyrimidine (PubChem CID 130611542) has the molecular formula C9H12FN3 and a molecular weight of 181.21 g/mol. Its IUPAC name is 2-(2,4-dimethylazetidin-1-yl)-5-fluoropyrimidine.
| Compound Name | 2-(2,4-dimethylazetidin-1-yl)-5-fluoropyrimidine |
|---|---|
| PubChem CID | 130611542 |
| Molecular Formula | C9H12FN3 |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-(2,4-dimethylazetidin-1-yl)-5-fluoropyrimidine |
| SMILES | CC1CC(C)N1c1ncc(F)cn1 |
| InChI | InChI=1S/C9H12FN3/c1-6-3-7(2)13(6)9-11-4-8(10)5-12-9/h4-7H,3H2,1-2H3 |
| InChIKey | QGRPPHLHJXXVLW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |