About 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one
6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one (PubChem CID 130611791) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one |
| PubChem CID | 130611791 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one |
| SMILES | CC(C)Nc1ccc2c(c1)C(=O)NC2 |
| InChI | InChI=1S/C11H14N2O/c1-7(2)13-9-4-3-8-6-12-11(14)10(8)5-9/h3-5,7,13H,6H2,1-2H3,(H,12,14) |
| InChIKey | QJKLTORXBLBIAK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one?
The IUPAC name of 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one (CID 130611791) is 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one?
The canonical SMILES for 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one is CC(C)Nc1ccc2c(c1)C(=O)NC2.
What is the InChIKey of 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one?
The InChIKey is QJKLTORXBLBIAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-7(2)13-9-4-3-8-6-12-11(14)10(8)5-9/h3-5,7,13H,6H2,1-2H3,(H,12,14).
What are the key properties of 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one?
6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one has a molecular weight of 190.25 g/mol, XLogP of 1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(propan-2-ylamino)-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 130611791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).