C9H9ClFN — CID 130612015
(1S)-4-chloro-7-fluoro-2,3-dihydro-1H-inden-1-amine (PubChem CID 130612015) has the molecular formula C9H9ClFN and a molecular weight of 185.63 g/mol. Its IUPAC name is (1S)-4-chloro-7-fluoro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S)-4-chloro-7-fluoro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 130612015 |
| Molecular Formula | C9H9ClFN |
| Molecular Weight | 185.63 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | (1S)-4-chloro-7-fluoro-2,3-dihydro-1H-inden-1-amine |
| SMILES | N[C@H]1CCc2c(Cl)ccc(F)c21 |
| InChI | InChI=1S/C9H9ClFN/c10-6-2-3-7(11)9-5(6)1-4-8(9)12/h2-3,8H,1,4,12H2/t8-/m0/s1 |
| InChIKey | QBIMXCIJODJPKG-QMMMGPOBSA-N |
| XLogP | 2.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.63 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |