About (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one
(4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one (PubChem CID 130612042) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one.
Molecular Properties
| Compound Name | (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one |
| PubChem CID | 130612042 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one |
| SMILES | C[C@@H]1CC2CC(CC1=O)C2(C)C |
| InChI | InChI=1S/C11H18O/c1-7-4-8-5-9(6-10(7)12)11(8,2)3/h7-9H,4-6H2,1-3H3/t7-,8?,9?/m1/s1 |
| InChIKey | UDWAYCNUKUCOPI-AFPNSQJFSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one?
The IUPAC name of (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one (CID 130612042) is (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one.
What is the SMILES notation for (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one?
The canonical SMILES for (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one is C[C@@H]1CC2CC(CC1=O)C2(C)C.
What is the InChIKey of (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one?
The InChIKey is UDWAYCNUKUCOPI-AFPNSQJFSA-N. The full InChI is InChI=1S/C11H18O/c1-7-4-8-5-9(6-10(7)12)11(8,2)3/h7-9H,4-6H2,1-3H3/t7-,8?,9?/m1/s1.
What are the key properties of (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one?
(4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one has a molecular weight of 166.26 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4,7,7-trimethylbicyclo[4.1.1]octan-3-one is sourced from PubChem (CID 130612042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).