C7H8Cl2F2N4 — CID 130612462
3,6-dichloro-N-(3,3-difluorobutyl)-1,2,4-triazin-5-amine (PubChem CID 130612462) has the molecular formula C7H8Cl2F2N4 and a molecular weight of 257.07 g/mol. Its IUPAC name is 3,6-dichloro-N-(3,3-difluorobutyl)-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-(3,3-difluorobutyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 130612462 |
| Molecular Formula | C7H8Cl2F2N4 |
| Molecular Weight | 257.07 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 3,6-dichloro-N-(3,3-difluorobutyl)-1,2,4-triazin-5-amine |
| SMILES | CC(F)(F)CCNc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C7H8Cl2F2N4/c1-7(10,11)2-3-12-5-4(8)14-15-6(9)13-5/h2-3H2,1H3,(H,12,13,15) |
| InChIKey | CQMKKDWGVFPDNR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.07 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |