C12H21NO2 — CID 13061355
2-[[(E)-but-2-enoxy]methyl]-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine (PubChem CID 13061355) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-[[(E)-but-2-enoxy]methyl]-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine.
| Compound Name | 2-[[(E)-but-2-enoxy]methyl]-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine |
|---|---|
| PubChem CID | 13061355 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-[[(E)-but-2-enoxy]methyl]-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine |
| SMILES | C/C=C/COCC1=NC(C)(C)CC(C)O1 |
| InChI | InChI=1S/C12H21NO2/c1-5-6-7-14-9-11-13-12(3,4)8-10(2)15-11/h5-6,10H,7-9H2,1-4H3/b6-5+ |
| InChIKey | MOSKAKRTMHFXDT-AATRIKPKSA-N |
| XLogP | 2.57 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|