About N-hydroxy-3,4-diiodobenzamide
N-hydroxy-3,4-diiodobenzamide (PubChem CID 130614181) has the molecular formula C7H5I2NO2
and a molecular weight of 388.93 g/mol. Its IUPAC name is N-hydroxy-3,4-diiodobenzamide.
Molecular Properties
| Compound Name | N-hydroxy-3,4-diiodobenzamide |
| PubChem CID | 130614181 |
| Molecular Formula | C7H5I2NO2 |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.84 |
| IUPAC Name | N-hydroxy-3,4-diiodobenzamide |
| SMILES | O=C(NO)c1ccc(I)c(I)c1 |
| InChI | InChI=1S/C7H5I2NO2/c8-5-2-1-4(3-6(5)9)7(11)10-12/h1-3,12H,(H,10,11) |
| InChIKey | JYNFDVXOYBGAKK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-3,4-diiodobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-3,4-diiodobenzamide?
The IUPAC name of N-hydroxy-3,4-diiodobenzamide (CID 130614181) is N-hydroxy-3,4-diiodobenzamide.
What is the SMILES notation for N-hydroxy-3,4-diiodobenzamide?
The canonical SMILES for N-hydroxy-3,4-diiodobenzamide is O=C(NO)c1ccc(I)c(I)c1.
What is the InChIKey of N-hydroxy-3,4-diiodobenzamide?
The InChIKey is JYNFDVXOYBGAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5I2NO2/c8-5-2-1-4(3-6(5)9)7(11)10-12/h1-3,12H,(H,10,11).
What are the key properties of N-hydroxy-3,4-diiodobenzamide?
N-hydroxy-3,4-diiodobenzamide has a molecular weight of 388.93 g/mol, XLogP of 2.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-3,4-diiodobenzamide is sourced from PubChem (CID 130614181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).