About 2-(5-chloro-1,3-thiazol-2-yl)oxazinane
2-(5-chloro-1,3-thiazol-2-yl)oxazinane (PubChem CID 130614325) has the molecular formula C7H9ClN2OS
and a molecular weight of 204.68 g/mol. Its IUPAC name is 2-(5-chloro-1,3-thiazol-2-yl)oxazinane.
Molecular Properties
| Compound Name | 2-(5-chloro-1,3-thiazol-2-yl)oxazinane |
| PubChem CID | 130614325 |
| Molecular Formula | C7H9ClN2OS |
| Molecular Weight | 204.68 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 2-(5-chloro-1,3-thiazol-2-yl)oxazinane |
| SMILES | Clc1cnc(N2CCCCO2)s1 |
| InChI | InChI=1S/C7H9ClN2OS/c8-6-5-9-7(12-6)10-3-1-2-4-11-10/h5H,1-4H2 |
| InChIKey | GFXWHJYGUKNXDE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.68 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-chloro-1,3-thiazol-2-yl)oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-1,3-thiazol-2-yl)oxazinane?
The IUPAC name of 2-(5-chloro-1,3-thiazol-2-yl)oxazinane (CID 130614325) is 2-(5-chloro-1,3-thiazol-2-yl)oxazinane.
What is the SMILES notation for 2-(5-chloro-1,3-thiazol-2-yl)oxazinane?
The canonical SMILES for 2-(5-chloro-1,3-thiazol-2-yl)oxazinane is Clc1cnc(N2CCCCO2)s1.
What is the InChIKey of 2-(5-chloro-1,3-thiazol-2-yl)oxazinane?
The InChIKey is GFXWHJYGUKNXDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2OS/c8-6-5-9-7(12-6)10-3-1-2-4-11-10/h5H,1-4H2.
What are the key properties of 2-(5-chloro-1,3-thiazol-2-yl)oxazinane?
2-(5-chloro-1,3-thiazol-2-yl)oxazinane has a molecular weight of 204.68 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-1,3-thiazol-2-yl)oxazinane is sourced from PubChem (CID 130614325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).