About N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide
N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide (PubChem CID 130614540) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide |
| PubChem CID | 130614540 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide |
| SMILES | N#CCNC(=O)C1=CCOCC1 |
| InChI | InChI=1S/C8H10N2O2/c9-3-4-10-8(11)7-1-5-12-6-2-7/h1H,2,4-6H2,(H,10,11) |
| InChIKey | UOOZMDHMMITFEA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide?
The IUPAC name of N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide (CID 130614540) is N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide.
What is the SMILES notation for N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide?
The canonical SMILES for N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide is N#CCNC(=O)C1=CCOCC1.
What is the InChIKey of N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide?
The InChIKey is UOOZMDHMMITFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c9-3-4-10-8(11)7-1-5-12-6-2-7/h1H,2,4-6H2,(H,10,11).
What are the key properties of N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide?
N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide has a molecular weight of 166.18 g/mol, XLogP of -0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-3,6-dihydro-2H-pyran-4-carboxamide is sourced from PubChem (CID 130614540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).