About 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one
3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 130614632) has the molecular formula C5H9N3O3S
and a molecular weight of 191.21 g/mol. Its IUPAC name is 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one |
| PubChem CID | 130614632 |
| Molecular Formula | C5H9N3O3S |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | CCS(=O)(=O)c1n[nH]c(=O)n1C |
| InChI | InChI=1S/C5H9N3O3S/c1-3-12(10,11)5-7-6-4(9)8(5)2/h3H2,1-2H3,(H,6,9) |
| InChIKey | GNFCLKGCDZUBAE-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one?
The IUPAC name of 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one (CID 130614632) is 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one is CCS(=O)(=O)c1n[nH]c(=O)n1C.
What is the InChIKey of 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one?
The InChIKey is GNFCLKGCDZUBAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O3S/c1-3-12(10,11)5-7-6-4(9)8(5)2/h3H2,1-2H3,(H,6,9).
What are the key properties of 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one?
3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one has a molecular weight of 191.21 g/mol, XLogP of -1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfonyl-4-methyl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 130614632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).