About 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid
3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid (PubChem CID 130614894) has the molecular formula C6H6ClNO3S
and a molecular weight of 207.64 g/mol. Its IUPAC name is 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid.
Molecular Properties
| Compound Name | 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid |
| PubChem CID | 130614894 |
| Molecular Formula | C6H6ClNO3S |
| Molecular Weight | 207.64 g/mol |
| Exact Mass | 206.98 |
| IUPAC Name | 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid |
| SMILES | O=C(O)CC(O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C6H6ClNO3S/c7-6-8-2-4(12-6)3(9)1-5(10)11/h2-3,9H,1H2,(H,10,11) |
| InChIKey | JDHSSHGXWHLOKD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.64 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid?
The IUPAC name of 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid (CID 130614894) is 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid.
What is the SMILES notation for 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid?
The canonical SMILES for 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid is O=C(O)CC(O)c1cnc(Cl)s1.
What is the InChIKey of 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid?
The InChIKey is JDHSSHGXWHLOKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO3S/c7-6-8-2-4(12-6)3(9)1-5(10)11/h2-3,9H,1H2,(H,10,11).
What are the key properties of 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid?
3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid has a molecular weight of 207.64 g/mol, XLogP of 1.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-1,3-thiazol-5-yl)-3-hydroxypropanoic acid is sourced from PubChem (CID 130614894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).