About 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine
2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine (PubChem CID 130616108) has the molecular formula C6H9BrN4S
and a molecular weight of 249.14 g/mol. Its IUPAC name is 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine.
Molecular Properties
| Compound Name | 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine |
| PubChem CID | 130616108 |
| Molecular Formula | C6H9BrN4S |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine |
| SMILES | NC(N)=NCCc1ncc(Br)s1 |
| InChI | InChI=1S/C6H9BrN4S/c7-4-3-11-5(12-4)1-2-10-6(8)9/h3H,1-2H2,(H4,8,9,10) |
| InChIKey | GGPSZBZPSULWMA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine?
The IUPAC name of 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine (CID 130616108) is 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine.
What is the SMILES notation for 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine?
The canonical SMILES for 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine is NC(N)=NCCc1ncc(Br)s1.
What is the InChIKey of 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine?
The InChIKey is GGPSZBZPSULWMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN4S/c7-4-3-11-5(12-4)1-2-10-6(8)9/h3H,1-2H2,(H4,8,9,10).
What are the key properties of 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine?
2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine has a molecular weight of 249.14 g/mol, XLogP of 0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(5-bromo-1,3-thiazol-2-yl)ethyl]guanidine is sourced from PubChem (CID 130616108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).