About N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide
N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide (PubChem CID 130616233) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide.
Molecular Properties
| Compound Name | N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide |
| PubChem CID | 130616233 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide |
| SMILES | CC(C#N)NC(=O)C1=CCCO1 |
| InChI | InChI=1S/C8H10N2O2/c1-6(5-9)10-8(11)7-3-2-4-12-7/h3,6H,2,4H2,1H3,(H,10,11) |
| InChIKey | NSFIOXPLLJTBKU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide?
The IUPAC name of N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide (CID 130616233) is N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide.
What is the SMILES notation for N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide?
The canonical SMILES for N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide is CC(C#N)NC(=O)C1=CCCO1.
What is the InChIKey of N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide?
The InChIKey is NSFIOXPLLJTBKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-6(5-9)10-8(11)7-3-2-4-12-7/h3,6H,2,4H2,1H3,(H,10,11).
What are the key properties of N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide?
N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide has a molecular weight of 166.18 g/mol, XLogP of 0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanoethyl)-2,3-dihydrofuran-5-carboxamide is sourced from PubChem (CID 130616233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).