methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate

C7H7FN2O4 — CID 13061640

IUPACmethyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate
SMILESCOC(=O)Cn1c(=O)[nH]cc(F)c1=O
InChIInChI=1S/C7H7FN2O4/c1-14-5(11)3-10-6(12)4(8)2-9-7(10)13/h2H,3H2,1H3,(H,9,13)
InChIKeyFAFLWPCJUOMVBL-UHFFFAOYSA-N
MW202.14 g/mol
LogP-1.15
Rot. Bonds2

About methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate

methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate (PubChem CID 13061640) has the molecular formula C7H7FN2O4 and a molecular weight of 202.14 g/mol. Its IUPAC name is methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate
PubChem CID13061640
Molecular FormulaC7H7FN2O4
Molecular Weight202.14 g/mol
Exact Mass202.04
IUPAC Namemethyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate
SMILESCOC(=O)Cn1c(=O)[nH]cc(F)c1=O
InChIInChI=1S/C7H7FN2O4/c1-14-5(11)3-10-6(12)4(8)2-9-7(10)13/h2H,3H2,1H3,(H,9,13)
InChIKeyFAFLWPCJUOMVBL-UHFFFAOYSA-N
XLogP-1.15
TPSA81.16 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.14
LogP ≤ 5-1.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate?
The IUPAC name of methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate (CID 13061640) is methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate.
What is the SMILES notation for methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate?
The canonical SMILES for methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate is COC(=O)Cn1c(=O)[nH]cc(F)c1=O.
What is the InChIKey of methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate?
The InChIKey is FAFLWPCJUOMVBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2O4/c1-14-5(11)3-10-6(12)4(8)2-9-7(10)13/h2H,3H2,1H3,(H,9,13).
What are the key properties of methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate?
methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate has a molecular weight of 202.14 g/mol, XLogP of -1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetate is sourced from PubChem (CID 13061640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).