About N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine
N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine (PubChem CID 130616474) has the molecular formula C9H16BrN3
and a molecular weight of 246.15 g/mol. Its IUPAC name is N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine.
Molecular Properties
| Compound Name | N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine |
| PubChem CID | 130616474 |
| Molecular Formula | C9H16BrN3 |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine |
| SMILES | CCN(C)Cn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C9H16BrN3/c1-5-12(4)6-13-8(3)9(10)7(2)11-13/h5-6H2,1-4H3 |
| InChIKey | DTXJBKWNNICJEE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine?
The IUPAC name of N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine (CID 130616474) is N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine.
What is the SMILES notation for N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine?
The canonical SMILES for N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine is CCN(C)Cn1nc(C)c(Br)c1C.
What is the InChIKey of N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine?
The InChIKey is DTXJBKWNNICJEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16BrN3/c1-5-12(4)6-13-8(3)9(10)7(2)11-13/h5-6H2,1-4H3.
What are the key properties of N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine?
N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine has a molecular weight of 246.15 g/mol, XLogP of 2.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-methylethanamine is sourced from PubChem (CID 130616474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).