C7H10N4O — CID 130616635
2-(2-amino-3-pyridinyl)acetohydrazide (PubChem CID 130616635) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-(2-amino-3-pyridinyl)acetohydrazide.
| Compound Name | 2-(2-amino-3-pyridinyl)acetohydrazide |
|---|---|
| PubChem CID | 130616635 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 2-(2-amino-3-pyridinyl)acetohydrazide |
| SMILES | NNC(=O)Cc1cccnc1N |
| InChI | InChI=1S/C7H10N4O/c8-7-5(2-1-3-10-7)4-6(12)11-9/h1-3H,4,9H2,(H2,8,10)(H,11,12) |
| InChIKey | BDTYUTQQGXSIDF-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|