About 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile
1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile (PubChem CID 130616981) has the molecular formula C8H8ClN3S
and a molecular weight of 213.69 g/mol. Its IUPAC name is 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile |
| PubChem CID | 130616981 |
| Molecular Formula | C8H8ClN3S |
| Molecular Weight | 213.69 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(CNc2csc(Cl)n2)CC1 |
| InChI | InChI=1S/C8H8ClN3S/c9-7-12-6(3-13-7)11-5-8(4-10)1-2-8/h3,11H,1-2,5H2 |
| InChIKey | UMVYXWRHJNAQEC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile?
The IUPAC name of 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile (CID 130616981) is 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile.
What is the SMILES notation for 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile?
The canonical SMILES for 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile is N#CC1(CNc2csc(Cl)n2)CC1.
What is the InChIKey of 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile?
The InChIKey is UMVYXWRHJNAQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3S/c9-7-12-6(3-13-7)11-5-8(4-10)1-2-8/h3,11H,1-2,5H2.
What are the key properties of 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile?
1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile has a molecular weight of 213.69 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2-chloro-1,3-thiazol-4-yl)amino]methyl]cyclopropane-1-carbonitrile is sourced from PubChem (CID 130616981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).