About (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride
(3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride (PubChem CID 130617405) has the molecular formula C8H16ClF3N2
and a molecular weight of 232.68 g/mol. Its IUPAC name is (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride |
| PubChem CID | 130617405 |
| Molecular Formula | C8H16ClF3N2 |
| Molecular Weight | 232.68 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride |
| SMILES | CC(CC(F)(F)F)N1CC[C@H](N)C1.Cl |
| InChI | InChI=1S/C8H15F3N2.ClH/c1-6(4-8(9,10)11)13-3-2-7(12)5-13;/h6-7H,2-5,12H2,1H3;1H/t6?,7-;/m0./s1 |
| InChIKey | ALPDOMVJDCRUQM-JWOPXBRZSA-N |
| XLogP | 1.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride?
The IUPAC name of (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride (CID 130617405) is (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride.
What is the SMILES notation for (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride?
The canonical SMILES for (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride is CC(CC(F)(F)F)N1CC[C@H](N)C1.Cl.
What is the InChIKey of (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride?
The InChIKey is ALPDOMVJDCRUQM-JWOPXBRZSA-N. The full InChI is InChI=1S/C8H15F3N2.ClH/c1-6(4-8(9,10)11)13-3-2-7(12)5-13;/h6-7H,2-5,12H2,1H3;1H/t6?,7-;/m0./s1.
What are the key properties of (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride?
(3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride has a molecular weight of 232.68 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(4,4,4-trifluorobutan-2-yl)pyrrolidin-3-amine;hydrochloride is sourced from PubChem (CID 130617405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).