C21H17Cl3F3NO3 — CID 13061814
2,2,2-trichloro-N-(furan-2-ylmethyl)-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]ethanamine (PubChem CID 13061814) has the molecular formula C21H17Cl3F3NO3 and a molecular weight of 494.72 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(furan-2-ylmethyl)-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]ethanamine.
| Compound Name | 2,2,2-trichloro-N-(furan-2-ylmethyl)-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 13061814 |
| Molecular Formula | C21H17Cl3F3NO3 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | 2,2,2-trichloro-N-(furan-2-ylmethyl)-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]ethanamine |
| SMILES | FC(F)(F)Oc1ccc(COc2ccc(C(NCc3ccco3)C(Cl)(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C21H17Cl3F3NO3/c22-20(23,24)19(28-12-18-2-1-11-29-18)15-5-9-16(10-6-15)30-13-14-3-7-17(8-4-14)31-21(25,26)27/h1-11,19,28H,12-13H2 |
| InChIKey | PVEYLZHTEYRIGI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|