C9H7F4N — CID 130618246
(2S)-2-(2,3,5,6-tetrafluorophenyl)azetidine (PubChem CID 130618246) has the molecular formula C9H7F4N and a molecular weight of 205.15 g/mol. Its IUPAC name is (2S)-2-(2,3,5,6-tetrafluorophenyl)azetidine.
| Compound Name | (2S)-2-(2,3,5,6-tetrafluorophenyl)azetidine |
|---|---|
| PubChem CID | 130618246 |
| Molecular Formula | C9H7F4N |
| Molecular Weight | 205.15 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | (2S)-2-(2,3,5,6-tetrafluorophenyl)azetidine |
| SMILES | Fc1cc(F)c(F)c([C@@H]2CCN2)c1F |
| InChI | InChI=1S/C9H7F4N/c10-4-3-5(11)9(13)7(8(4)12)6-1-2-14-6/h3,6,14H,1-2H2/t6-/m0/s1 |
| InChIKey | NBRVMTFXBRRANT-LURJTMIESA-N |
| XLogP | 2.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|